C17H11F7OS — CID 12134405
1-[2-Methyl-5-(p-anisyl)-3-thienyl]-2,3,3,4,4,5,5-heptafluoro-1-cyclopentene (PubChem CID 12134405) has the molecular formula C17H11F7OS and a molecular weight of 396.30 g/mol. Its IUPAC name is 3-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)-5-(4-methoxyphenyl)-2-methylthiophene.
| Compound Name | 1-[2-Methyl-5-(p-anisyl)-3-thienyl]-2,3,3,4,4,5,5-heptafluoro-1-cyclopentene |
|---|---|
| PubChem CID | 12134405 |
| Molecular Formula | C17H11F7OS |
| Molecular Weight | 396.30 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 3-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)-5-(4-methoxyphenyl)-2-methylthiophene |
| SMILES | CC1=C(C=C(S1)C2=CC=C(C=C2)OC)C3=C(C(C(C3(F)F)(F)F)(F)F)F |
| InChI | InChI=1S/C17H11F7OS/c1-8-11(7-12(26-8)9-3-5-10(25-2)6-4-9)13-14(18)16(21,22)17(23,24)15(13,19)20/h3-7H,1-2H3 |
| InChIKey | KJDRCHULZJBVQS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 37.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | 584 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.30 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|