About 4-benzyl-N-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide
4-benzyl-N-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide (PubChem CID 1213442) has the molecular formula C20H25N3O2S
and a molecular weight of 371.51 g/mol. Its IUPAC name is 4-benzyl-N-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide.
Molecular Properties
| Compound Name | 4-benzyl-N-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide |
| PubChem CID | 1213442 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 4-benzyl-N-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide |
| SMILES | COc1ccc(NC(=S)N2CCN(Cc3ccccc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C20H25N3O2S/c1-24-17-8-9-18(19(14-17)25-2)21-20(26)23-12-10-22(11-13-23)15-16-6-4-3-5-7-16/h3-9,14H,10-13,15H2,1-2H3,(H,21,26) |
| InChIKey | LQHDXDUWFNAZRK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-benzyl-N-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-N-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide?
The IUPAC name of 4-benzyl-N-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide (CID 1213442) is 4-benzyl-N-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide.
What is the SMILES notation for 4-benzyl-N-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide?
The canonical SMILES for 4-benzyl-N-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide is COc1ccc(NC(=S)N2CCN(Cc3ccccc3)CC2)c(OC)c1.
What is the InChIKey of 4-benzyl-N-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide?
The InChIKey is LQHDXDUWFNAZRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N3O2S/c1-24-17-8-9-18(19(14-17)25-2)21-20(26)23-12-10-22(11-13-23)15-16-6-4-3-5-7-16/h3-9,14H,10-13,15H2,1-2H3,(H,21,26).
What are the key properties of 4-benzyl-N-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide?
4-benzyl-N-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide has a molecular weight of 371.51 g/mol, XLogP of 3.22, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-N-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide is sourced from PubChem (CID 1213442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).