About 1-ethylpiperazin-2-amine;hydrazine
1-ethylpiperazin-2-amine;hydrazine (PubChem CID 121344900) has the molecular formula C6H19N5
and a molecular weight of 161.25 g/mol. Its IUPAC name is 1-ethylpiperazin-2-amine;hydrazine.
Molecular Properties
| Compound Name | 1-ethylpiperazin-2-amine;hydrazine |
| PubChem CID | 121344900 |
| Molecular Formula | C6H19N5 |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.16 |
| IUPAC Name | 1-ethylpiperazin-2-amine;hydrazine |
| SMILES | CCN1CCNCC1N.NN |
| InChI | InChI=1S/C6H15N3.H4N2/c1-2-9-4-3-8-5-6(9)7;1-2/h6,8H,2-5,7H2,1H3;1-2H2 |
| InChIKey | FDRUFUXGYHTIBU-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethylpiperazin-2-amine;hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylpiperazin-2-amine;hydrazine?
The IUPAC name of 1-ethylpiperazin-2-amine;hydrazine (CID 121344900) is 1-ethylpiperazin-2-amine;hydrazine.
What is the SMILES notation for 1-ethylpiperazin-2-amine;hydrazine?
The canonical SMILES for 1-ethylpiperazin-2-amine;hydrazine is CCN1CCNCC1N.NN.
What is the InChIKey of 1-ethylpiperazin-2-amine;hydrazine?
The InChIKey is FDRUFUXGYHTIBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N3.H4N2/c1-2-9-4-3-8-5-6(9)7;1-2/h6,8H,2-5,7H2,1H3;1-2H2.
What are the key properties of 1-ethylpiperazin-2-amine;hydrazine?
1-ethylpiperazin-2-amine;hydrazine has a molecular weight of 161.25 g/mol, XLogP of -1.98, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylpiperazin-2-amine;hydrazine is sourced from PubChem (CID 121344900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).