C20H21F3N6O3 — CID 121344978
[(2R,5R)-2-methyl-5-[5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]-[2-(triazol-2-yl)phenyl]methanone (PubChem CID 121344978) has the molecular formula C20H21F3N6O3 and a molecular weight of 450.42 g/mol. Its IUPAC name is [(2R,5R)-2-methyl-5-[5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]-[2-(triazol-2-yl)phenyl]methanone.
| Compound Name | [(2R,5R)-2-methyl-5-[5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]-[2-(triazol-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 121344978 |
| Molecular Formula | C20H21F3N6O3 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | [(2R,5R)-2-methyl-5-[5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]-[2-(triazol-2-yl)phenyl]methanone |
| SMILES | C[C@@H]1CC[C@@H](c2noc(C(C)(O)C(F)(F)F)n2)CN1C(=O)c1ccccc1-n1nccn1 |
| InChI | InChI=1S/C20H21F3N6O3/c1-12-7-8-13(16-26-18(32-27-16)19(2,31)20(21,22)23)11-28(12)17(30)14-5-3-4-6-15(14)29-24-9-10-25-29/h3-6,9-10,12-13,31H,7-8,11H2,1-2H3/t12-,13-,19?/m1/s1 |
| InChIKey | KPGZOEVIQMVXEA-XIOSEYODSA-N |
| XLogP | 2.83 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |