C27H30F3N3O5 — CID 121345383
(4S)-4-[4-cyclopropyl-5-[5-(1,1-difluoro-2,2-dimethylpropyl)-1,2-oxazol-3-yl]-1,2-oxazol-3-yl]-6-(2-fluoro-4-methylanilino)-6-oxohexanoic acid (PubChem CID 121345383) has the molecular formula C27H30F3N3O5 and a molecular weight of 533.55 g/mol. Its IUPAC name is (4S)-4-[4-cyclopropyl-5-[5-(1,1-difluoro-2,2-dimethylpropyl)-1,2-oxazol-3-yl]-1,2-oxazol-3-yl]-6-(2-fluoro-4-methylanilino)-6-oxohexanoic acid.
| Compound Name | (4S)-4-[4-cyclopropyl-5-[5-(1,1-difluoro-2,2-dimethylpropyl)-1,2-oxazol-3-yl]-1,2-oxazol-3-yl]-6-(2-fluoro-4-methylanilino)-6-oxohexanoic acid |
|---|---|
| PubChem CID | 121345383 |
| Molecular Formula | C27H30F3N3O5 |
| Molecular Weight | 533.55 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | (4S)-4-[4-cyclopropyl-5-[5-(1,1-difluoro-2,2-dimethylpropyl)-1,2-oxazol-3-yl]-1,2-oxazol-3-yl]-6-(2-fluoro-4-methylanilino)-6-oxohexanoic acid |
| SMILES | Cc1ccc(NC(=O)C[C@H](CCC(=O)O)c2noc(-c3cc(C(F)(F)C(C)(C)C)on3)c2C2CC2)c(F)c1 |
| InChI | InChI=1S/C27H30F3N3O5/c1-14-5-9-18(17(28)11-14)31-21(34)12-16(8-10-22(35)36)24-23(15-6-7-15)25(38-33-24)19-13-20(37-32-19)27(29,30)26(2,3)4/h5,9,11,13,15-16H,6-8,10,12H2,1-4H3,(H,31,34)(H,35,36)/t16-/m0/s1 |
| InChIKey | ZOCNFSFZDQBOPT-INIZCTEOSA-N |
| XLogP | 6.77 |
| TPSA | 118.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.55 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |