About 5-ethyl-3,4-di(propan-2-yl)-1,2-oxazole
5-ethyl-3,4-di(propan-2-yl)-1,2-oxazole (PubChem CID 121345564) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 5-ethyl-3,4-di(propan-2-yl)-1,2-oxazole.
Molecular Properties
| Compound Name | 5-ethyl-3,4-di(propan-2-yl)-1,2-oxazole |
| PubChem CID | 121345564 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 5-ethyl-3,4-di(propan-2-yl)-1,2-oxazole |
| SMILES | CCc1onc(C(C)C)c1C(C)C |
| InChI | InChI=1S/C11H19NO/c1-6-9-10(7(2)3)11(8(4)5)12-13-9/h7-8H,6H2,1-5H3 |
| InChIKey | DVQPXPFCYWPJHF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyl-3,4-di(propan-2-yl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-3,4-di(propan-2-yl)-1,2-oxazole?
The IUPAC name of 5-ethyl-3,4-di(propan-2-yl)-1,2-oxazole (CID 121345564) is 5-ethyl-3,4-di(propan-2-yl)-1,2-oxazole.
What is the SMILES notation for 5-ethyl-3,4-di(propan-2-yl)-1,2-oxazole?
The canonical SMILES for 5-ethyl-3,4-di(propan-2-yl)-1,2-oxazole is CCc1onc(C(C)C)c1C(C)C.
What is the InChIKey of 5-ethyl-3,4-di(propan-2-yl)-1,2-oxazole?
The InChIKey is DVQPXPFCYWPJHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO/c1-6-9-10(7(2)3)11(8(4)5)12-13-9/h7-8H,6H2,1-5H3.
What are the key properties of 5-ethyl-3,4-di(propan-2-yl)-1,2-oxazole?
5-ethyl-3,4-di(propan-2-yl)-1,2-oxazole has a molecular weight of 181.28 g/mol, XLogP of 3.48, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-3,4-di(propan-2-yl)-1,2-oxazole is sourced from PubChem (CID 121345564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).