About 1-ethenyl-2-methoxy-5-(2-methylbutan-2-yl)-3-propa-1,2-dienylbenzene
1-ethenyl-2-methoxy-5-(2-methylbutan-2-yl)-3-propa-1,2-dienylbenzene (PubChem CID 121345575) has the molecular formula C17H22O
and a molecular weight of 242.36 g/mol. Its IUPAC name is 1-ethenyl-2-methoxy-5-(2-methylbutan-2-yl)-3-propa-1,2-dienylbenzene.
Molecular Properties
| Compound Name | 1-ethenyl-2-methoxy-5-(2-methylbutan-2-yl)-3-propa-1,2-dienylbenzene |
| PubChem CID | 121345575 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 1-ethenyl-2-methoxy-5-(2-methylbutan-2-yl)-3-propa-1,2-dienylbenzene |
| SMILES | C=C=Cc1cc(C(C)(C)CC)cc(C=C)c1OC |
| InChI | InChI=1S/C17H22O/c1-7-10-14-12-15(17(4,5)9-3)11-13(8-2)16(14)18-6/h8,10-12H,1-2,9H2,3-6H3 |
| InChIKey | XZAYZVJHVVCBHN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethenyl-2-methoxy-5-(2-methylbutan-2-yl)-3-propa-1,2-dienylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-2-methoxy-5-(2-methylbutan-2-yl)-3-propa-1,2-dienylbenzene?
The IUPAC name of 1-ethenyl-2-methoxy-5-(2-methylbutan-2-yl)-3-propa-1,2-dienylbenzene (CID 121345575) is 1-ethenyl-2-methoxy-5-(2-methylbutan-2-yl)-3-propa-1,2-dienylbenzene.
What is the SMILES notation for 1-ethenyl-2-methoxy-5-(2-methylbutan-2-yl)-3-propa-1,2-dienylbenzene?
The canonical SMILES for 1-ethenyl-2-methoxy-5-(2-methylbutan-2-yl)-3-propa-1,2-dienylbenzene is C=C=Cc1cc(C(C)(C)CC)cc(C=C)c1OC.
What is the InChIKey of 1-ethenyl-2-methoxy-5-(2-methylbutan-2-yl)-3-propa-1,2-dienylbenzene?
The InChIKey is XZAYZVJHVVCBHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22O/c1-7-10-14-12-15(17(4,5)9-3)11-13(8-2)16(14)18-6/h8,10-12H,1-2,9H2,3-6H3.
What are the key properties of 1-ethenyl-2-methoxy-5-(2-methylbutan-2-yl)-3-propa-1,2-dienylbenzene?
1-ethenyl-2-methoxy-5-(2-methylbutan-2-yl)-3-propa-1,2-dienylbenzene has a molecular weight of 242.36 g/mol, XLogP of 4.82, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-2-methoxy-5-(2-methylbutan-2-yl)-3-propa-1,2-dienylbenzene is sourced from PubChem (CID 121345575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).