C26H45N3O3 — CID 121345624
(3S)-6-butoxy-3-[5-cyclopropyl-1-[3-(2,2,3-trimethylbutyl)cyclobutyl]triazol-4-yl]hexanoic acid (PubChem CID 121345624) has the molecular formula C26H45N3O3 and a molecular weight of 447.66 g/mol. Its IUPAC name is (3S)-6-butoxy-3-[5-cyclopropyl-1-[3-(2,2,3-trimethylbutyl)cyclobutyl]triazol-4-yl]hexanoic acid.
| Compound Name | (3S)-6-butoxy-3-[5-cyclopropyl-1-[3-(2,2,3-trimethylbutyl)cyclobutyl]triazol-4-yl]hexanoic acid |
|---|---|
| PubChem CID | 121345624 |
| Molecular Formula | C26H45N3O3 |
| Molecular Weight | 447.66 g/mol |
| Exact Mass | 447.35 |
| IUPAC Name | (3S)-6-butoxy-3-[5-cyclopropyl-1-[3-(2,2,3-trimethylbutyl)cyclobutyl]triazol-4-yl]hexanoic acid |
| SMILES | CCCCOCCC[C@@H](CC(=O)O)c1nnn(C2CC(CC(C)(C)C(C)C)C2)c1C1CC1 |
| InChI | InChI=1S/C26H45N3O3/c1-6-7-12-32-13-8-9-21(16-23(30)31)24-25(20-10-11-20)29(28-27-24)22-14-19(15-22)17-26(4,5)18(2)3/h18-22H,6-17H2,1-5H3,(H,30,31)/t19?,21-,22?/m0/s1 |
| InChIKey | DBLIAPZOAMTAHH-IRQNMHNUSA-N |
| XLogP | 6.33 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.66 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|