C29H41ClN4O3 — CID 121345771
(4S)-6-(2-chloro-4-methylanilino)-4-[4-cyclopropyl-5-[3-(2,2,3-trimethylbutyl)cyclobutyl]-1,2,4-triazol-3-yl]-6-oxohexanoic acid (PubChem CID 121345771) has the molecular formula C29H41ClN4O3 and a molecular weight of 529.13 g/mol. Its IUPAC name is (4S)-6-(2-chloro-4-methylanilino)-4-[4-cyclopropyl-5-[3-(2,2,3-trimethylbutyl)cyclobutyl]-1,2,4-triazol-3-yl]-6-oxohexanoic acid.
| Compound Name | (4S)-6-(2-chloro-4-methylanilino)-4-[4-cyclopropyl-5-[3-(2,2,3-trimethylbutyl)cyclobutyl]-1,2,4-triazol-3-yl]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 121345771 |
| Molecular Formula | C29H41ClN4O3 |
| Molecular Weight | 529.13 g/mol |
| Exact Mass | 528.29 |
| IUPAC Name | (4S)-6-(2-chloro-4-methylanilino)-4-[4-cyclopropyl-5-[3-(2,2,3-trimethylbutyl)cyclobutyl]-1,2,4-triazol-3-yl]-6-oxohexanoic acid |
| SMILES | Cc1ccc(NC(=O)C[C@H](CCC(=O)O)c2nnc(C3CC(CC(C)(C)C(C)C)C3)n2C2CC2)c(Cl)c1 |
| InChI | InChI=1S/C29H41ClN4O3/c1-17(2)29(4,5)16-19-13-21(14-19)28-33-32-27(34(28)22-8-9-22)20(7-11-26(36)37)15-25(35)31-24-10-6-18(3)12-23(24)30/h6,10,12,17,19-22H,7-9,11,13-16H2,1-5H3,(H,31,35)(H,36,37)/t19?,20-,21?/m0/s1 |
| InChIKey | DULAIQZDYCUYDM-KBWCOIMZSA-N |
| XLogP | 7.12 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.13 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |