About tert-butyl (3S)-6-butoxy-3-(5-cyano-4-cyclopropyl-1,2-oxazol-3-yl)hexanoate
tert-butyl (3S)-6-butoxy-3-(5-cyano-4-cyclopropyl-1,2-oxazol-3-yl)hexanoate (PubChem CID 121345928) has the molecular formula C21H32N2O4
and a molecular weight of 376.50 g/mol. Its IUPAC name is tert-butyl (3S)-6-butoxy-3-(5-cyano-4-cyclopropyl-1,2-oxazol-3-yl)hexanoate.
Molecular Properties
| Compound Name | tert-butyl (3S)-6-butoxy-3-(5-cyano-4-cyclopropyl-1,2-oxazol-3-yl)hexanoate |
| PubChem CID | 121345928 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | tert-butyl (3S)-6-butoxy-3-(5-cyano-4-cyclopropyl-1,2-oxazol-3-yl)hexanoate |
| SMILES | CCCCOCCCC(CC(=O)OC(C)(C)C)c1noc(C#N)c1C1CC1 |
| InChI | InChI=1S/C21H32N2O4/c1-5-6-11-25-12-7-8-16(13-18(24)26-21(2,3)4)20-19(15-9-10-15)17(14-22)27-23-20/h15-16H,5-13H2,1-4H3 |
| InChIKey | XKEAUNOHPHGMET-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (3S)-6-butoxy-3-(5-cyano-4-cyclopropyl-1,2-oxazol-3-yl)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3S)-6-butoxy-3-(5-cyano-4-cyclopropyl-1,2-oxazol-3-yl)hexanoate?
The IUPAC name of tert-butyl (3S)-6-butoxy-3-(5-cyano-4-cyclopropyl-1,2-oxazol-3-yl)hexanoate (CID 121345928) is tert-butyl (3S)-6-butoxy-3-(5-cyano-4-cyclopropyl-1,2-oxazol-3-yl)hexanoate.
What is the SMILES notation for tert-butyl (3S)-6-butoxy-3-(5-cyano-4-cyclopropyl-1,2-oxazol-3-yl)hexanoate?
The canonical SMILES for tert-butyl (3S)-6-butoxy-3-(5-cyano-4-cyclopropyl-1,2-oxazol-3-yl)hexanoate is CCCCOCCCC(CC(=O)OC(C)(C)C)c1noc(C#N)c1C1CC1.
What is the InChIKey of tert-butyl (3S)-6-butoxy-3-(5-cyano-4-cyclopropyl-1,2-oxazol-3-yl)hexanoate?
The InChIKey is XKEAUNOHPHGMET-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32N2O4/c1-5-6-11-25-12-7-8-16(13-18(24)26-21(2,3)4)20-19(15-9-10-15)17(14-22)27-23-20/h15-16H,5-13H2,1-4H3.
What are the key properties of tert-butyl (3S)-6-butoxy-3-(5-cyano-4-cyclopropyl-1,2-oxazol-3-yl)hexanoate?
tert-butyl (3S)-6-butoxy-3-(5-cyano-4-cyclopropyl-1,2-oxazol-3-yl)hexanoate has a molecular weight of 376.50 g/mol, XLogP of 4.84, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3S)-6-butoxy-3-(5-cyano-4-cyclopropyl-1,2-oxazol-3-yl)hexanoate is sourced from PubChem (CID 121345928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).