C16H20F5N3O4 — CID 121347092
[6-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl] N-[3-(methylcarbamoyl)pentan-3-yl]carbamate (PubChem CID 121347092) has the molecular formula C16H20F5N3O4 and a molecular weight of 413.34 g/mol. Its IUPAC name is [6-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl] N-[3-(methylcarbamoyl)pentan-3-yl]carbamate.
| Compound Name | [6-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl] N-[3-(methylcarbamoyl)pentan-3-yl]carbamate |
|---|---|
| PubChem CID | 121347092 |
| Molecular Formula | C16H20F5N3O4 |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | [6-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl] N-[3-(methylcarbamoyl)pentan-3-yl]carbamate |
| SMILES | CCC(CC)(NC(=O)Oc1cccc(OCC(F)(F)C(F)(F)F)n1)C(=O)NC |
| InChI | InChI=1S/C16H20F5N3O4/c1-4-14(5-2,12(25)22-3)24-13(26)28-11-8-6-7-10(23-11)27-9-15(17,18)16(19,20)21/h6-8H,4-5,9H2,1-3H3,(H,22,25)(H,24,26) |
| InChIKey | SFNDZMMWXYRROT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|