C19H24F5N3O4 — CID 121347121
[5-cyclopropyl-6-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl] N-[3-(methylcarbamoyl)pentan-3-yl]carbamate (PubChem CID 121347121) has the molecular formula C19H24F5N3O4 and a molecular weight of 453.41 g/mol. Its IUPAC name is [5-cyclopropyl-6-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl] N-[3-(methylcarbamoyl)pentan-3-yl]carbamate.
| Compound Name | [5-cyclopropyl-6-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl] N-[3-(methylcarbamoyl)pentan-3-yl]carbamate |
|---|---|
| PubChem CID | 121347121 |
| Molecular Formula | C19H24F5N3O4 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | [5-cyclopropyl-6-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl] N-[3-(methylcarbamoyl)pentan-3-yl]carbamate |
| SMILES | CCC(CC)(NC(=O)Oc1ccc(C2CC2)c(OCC(F)(F)C(F)(F)F)n1)C(=O)NC |
| InChI | InChI=1S/C19H24F5N3O4/c1-4-17(5-2,15(28)25-3)27-16(29)31-13-9-8-12(11-6-7-11)14(26-13)30-10-18(20,21)19(22,23)24/h8-9,11H,4-7,10H2,1-3H3,(H,25,28)(H,27,29) |
| InChIKey | WVZNVAFKUYHUKW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|