C20H26F5N3O4 — CID 121347140
[5-cyclopropyl-6-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl] N-[(2S)-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl]carbamate (PubChem CID 121347140) has the molecular formula C20H26F5N3O4 and a molecular weight of 467.44 g/mol. Its IUPAC name is [5-cyclopropyl-6-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl] N-[(2S)-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl]carbamate.
| Compound Name | [5-cyclopropyl-6-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl] N-[(2S)-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 121347140 |
| Molecular Formula | C20H26F5N3O4 |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | [5-cyclopropyl-6-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl] N-[(2S)-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl]carbamate |
| SMILES | CNC(=O)[C@H](CC(C)(C)C)NC(=O)Oc1ccc(C2CC2)c(OCC(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C20H26F5N3O4/c1-18(2,3)9-13(15(29)26-4)27-17(30)32-14-8-7-12(11-5-6-11)16(28-14)31-10-19(21,22)20(23,24)25/h7-8,11,13H,5-6,9-10H2,1-4H3,(H,26,29)(H,27,30)/t13-/m0/s1 |
| InChIKey | HOQBRTCEZRBPLK-ZDUSSCGKSA-N |
| XLogP | 4.17 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|