C10H20NO4+ — CID 121348017
butyl-dihydroxy-(3-prop-2-enoyloxypropyl)azanium (PubChem CID 121348017) has the molecular formula C10H20NO4+ and a molecular weight of 218.27 g/mol. Its IUPAC name is butyl-dihydroxy-(3-prop-2-enoyloxypropyl)azanium.
| Compound Name | butyl-dihydroxy-(3-prop-2-enoyloxypropyl)azanium |
|---|---|
| PubChem CID | 121348017 |
| Molecular Formula | C10H20NO4+ |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | butyl-dihydroxy-(3-prop-2-enoyloxypropyl)azanium |
| SMILES | C=CC(=O)OCCC[N+](O)(O)CCCC |
| InChI | InChI=1S/C10H20NO4/c1-3-5-7-11(13,14)8-6-9-15-10(12)4-2/h4,13-14H,2-3,5-9H2,1H3/q+1 |
| InChIKey | PISPUKUDMXGNIR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|