C22H17F6N9O — CID 121348158
4-amino-5-(5-fluoro-2-pyridinyl)-5-methyl-2-[2-methyl-8-(3,3,4,4,4-pentafluorobutyl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 121348158) has the molecular formula C22H17F6N9O and a molecular weight of 537.43 g/mol. Its IUPAC name is 4-amino-5-(5-fluoro-2-pyridinyl)-5-methyl-2-[2-methyl-8-(3,3,4,4,4-pentafluorobutyl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-5-(5-fluoro-2-pyridinyl)-5-methyl-2-[2-methyl-8-(3,3,4,4,4-pentafluorobutyl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 121348158 |
| Molecular Formula | C22H17F6N9O |
| Molecular Weight | 537.43 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | 4-amino-5-(5-fluoro-2-pyridinyl)-5-methyl-2-[2-methyl-8-(3,3,4,4,4-pentafluorobutyl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | Cc1nc2c(CCC(F)(F)C(F)(F)F)nc(-c3nc(N)c4c(n3)NC(=O)C4(C)c3ccc(F)cn3)cn2n1 |
| InChI | InChI=1S/C22H17F6N9O/c1-9-31-18-11(5-6-21(24,25)22(26,27)28)32-12(8-37(18)36-9)16-33-15(29)14-17(34-16)35-19(38)20(14,2)13-4-3-10(23)7-30-13/h3-4,7-8H,5-6H2,1-2H3,(H3,29,33,34,35,38) |
| InChIKey | AEBCGVWPSRBCKM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|