C22H17ClF4N8O — CID 121348241
4-amino-5-(4-chloro-3-fluorophenyl)-5-methyl-2-[8-(4,4,4-trifluorobutyl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 121348241) has the molecular formula C22H17ClF4N8O and a molecular weight of 520.88 g/mol. Its IUPAC name is 4-amino-5-(4-chloro-3-fluorophenyl)-5-methyl-2-[8-(4,4,4-trifluorobutyl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-5-(4-chloro-3-fluorophenyl)-5-methyl-2-[8-(4,4,4-trifluorobutyl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 121348241 |
| Molecular Formula | C22H17ClF4N8O |
| Molecular Weight | 520.88 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | 4-amino-5-(4-chloro-3-fluorophenyl)-5-methyl-2-[8-(4,4,4-trifluorobutyl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CC1(c2ccc(Cl)c(F)c2)C(=O)Nc2nc(-c3cn4ncnc4c(CCCC(F)(F)F)n3)nc(N)c21 |
| InChI | InChI=1S/C22H17ClF4N8O/c1-21(10-4-5-11(23)12(24)7-10)15-16(28)32-17(33-18(15)34-20(21)36)14-8-35-19(29-9-30-35)13(31-14)3-2-6-22(25,26)27/h4-5,7-9H,2-3,6H2,1H3,(H3,28,32,33,34,36) |
| InChIKey | FQFPGEPRBPWOPZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 123.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.88 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |