C21H15ClF4N8O — CID 121348244
4-amino-5-(4-chloro-3-fluorophenyl)-5-methyl-2-[8-(3,3,3-trifluoropropyl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 121348244) has the molecular formula C21H15ClF4N8O and a molecular weight of 506.85 g/mol. Its IUPAC name is 4-amino-5-(4-chloro-3-fluorophenyl)-5-methyl-2-[8-(3,3,3-trifluoropropyl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-5-(4-chloro-3-fluorophenyl)-5-methyl-2-[8-(3,3,3-trifluoropropyl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 121348244 |
| Molecular Formula | C21H15ClF4N8O |
| Molecular Weight | 506.85 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | 4-amino-5-(4-chloro-3-fluorophenyl)-5-methyl-2-[8-(3,3,3-trifluoropropyl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CC1(c2ccc(Cl)c(F)c2)C(=O)Nc2nc(-c3cn4ncnc4c(CCC(F)(F)F)n3)nc(N)c21 |
| InChI | InChI=1S/C21H15ClF4N8O/c1-20(9-2-3-10(22)11(23)6-9)14-15(27)31-16(32-17(14)33-19(20)35)13-7-34-18(28-8-29-34)12(30-13)4-5-21(24,25)26/h2-3,6-8H,4-5H2,1H3,(H3,27,31,32,33,35) |
| InChIKey | ILAXOCFPUSBEAT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 123.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.85 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |