C23H17ClF6N8O — CID 121348250
4-amino-5-(4-chloro-3-fluorophenyl)-5-methyl-2-[2-methyl-8-(3,3,4,4,4-pentafluorobutyl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 121348250) has the molecular formula C23H17ClF6N8O and a molecular weight of 570.89 g/mol. Its IUPAC name is 4-amino-5-(4-chloro-3-fluorophenyl)-5-methyl-2-[2-methyl-8-(3,3,4,4,4-pentafluorobutyl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-5-(4-chloro-3-fluorophenyl)-5-methyl-2-[2-methyl-8-(3,3,4,4,4-pentafluorobutyl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 121348250 |
| Molecular Formula | C23H17ClF6N8O |
| Molecular Weight | 570.89 g/mol |
| Exact Mass | 570.11 |
| IUPAC Name | 4-amino-5-(4-chloro-3-fluorophenyl)-5-methyl-2-[2-methyl-8-(3,3,4,4,4-pentafluorobutyl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | Cc1nc2c(CCC(F)(F)C(F)(F)F)nc(-c3nc(N)c4c(n3)NC(=O)C4(C)c3ccc(Cl)c(F)c3)cn2n1 |
| InChI | InChI=1S/C23H17ClF6N8O/c1-9-32-19-13(5-6-22(26,27)23(28,29)30)33-14(8-38(19)37-9)17-34-16(31)15-18(35-17)36-20(39)21(15,2)10-3-4-11(24)12(25)7-10/h3-4,7-8H,5-6H2,1-2H3,(H3,31,34,35,36,39) |
| InChIKey | CELKENQCRLDWBN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 123.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.89 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|