C10H11F3N6 — CID 121348261
8-(4,4,4-trifluorobutyl)-[1,2,4]triazolo[1,5-a]pyrazine-6-carboximidamide (PubChem CID 121348261) has the molecular formula C10H11F3N6 and a molecular weight of 272.23 g/mol. Its IUPAC name is 8-(4,4,4-trifluorobutyl)-[1,2,4]triazolo[1,5-a]pyrazine-6-carboximidamide.
| Compound Name | 8-(4,4,4-trifluorobutyl)-[1,2,4]triazolo[1,5-a]pyrazine-6-carboximidamide |
|---|---|
| PubChem CID | 121348261 |
| Molecular Formula | C10H11F3N6 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 8-(4,4,4-trifluorobutyl)-[1,2,4]triazolo[1,5-a]pyrazine-6-carboximidamide |
| SMILES | [H]/N=C(\N)c1cn2ncnc2c(CCCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H11F3N6/c11-10(12,13)3-1-2-6-9-16-5-17-19(9)4-7(18-6)8(14)15/h4-5H,1-3H2,(H3,14,15) |
| InChIKey | YVFAFNJAPAHZAS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|