C24H20F5N9O — CID 121348264
4-amino-5-cyclopropyl-5-(5-methyl-2-pyridinyl)-2-[8-(3,3,4,4,4-pentafluorobutyl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 121348264) has the molecular formula C24H20F5N9O and a molecular weight of 545.48 g/mol. Its IUPAC name is 4-amino-5-cyclopropyl-5-(5-methyl-2-pyridinyl)-2-[8-(3,3,4,4,4-pentafluorobutyl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-5-cyclopropyl-5-(5-methyl-2-pyridinyl)-2-[8-(3,3,4,4,4-pentafluorobutyl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 121348264 |
| Molecular Formula | C24H20F5N9O |
| Molecular Weight | 545.48 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | 4-amino-5-cyclopropyl-5-(5-methyl-2-pyridinyl)-2-[8-(3,3,4,4,4-pentafluorobutyl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | Cc1ccc(C2(C3CC3)C(=O)Nc3nc(-c4cn5ncnc5c(CCC(F)(F)C(F)(F)F)n4)nc(N)c32)nc1 |
| InChI | InChI=1S/C24H20F5N9O/c1-11-2-5-15(31-8-11)23(12-3-4-12)16-17(30)35-18(36-19(16)37-21(23)39)14-9-38-20(32-10-33-38)13(34-14)6-7-22(25,26)24(27,28)29/h2,5,8-10,12H,3-4,6-7H2,1H3,(H3,30,35,36,37,39) |
| InChIKey | YCSHDNZHOLZUCA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|