About 2,7-dimethylimidazo[1,2-a]pyridin-6-amine;hydrochloride
2,7-dimethylimidazo[1,2-a]pyridin-6-amine;hydrochloride (PubChem CID 121348410) has the molecular formula C9H12ClN3
and a molecular weight of 197.67 g/mol. Its IUPAC name is 2,7-dimethylimidazo[1,2-a]pyridin-6-amine;hydrochloride.
Molecular Properties
| Compound Name | 2,7-dimethylimidazo[1,2-a]pyridin-6-amine;hydrochloride |
| PubChem CID | 121348410 |
| Molecular Formula | C9H12ClN3 |
| Molecular Weight | 197.67 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 2,7-dimethylimidazo[1,2-a]pyridin-6-amine;hydrochloride |
| SMILES | Cc1cn2cc(N)c(C)cc2n1.Cl |
| InChI | InChI=1S/C9H11N3.ClH/c1-6-3-9-11-7(2)4-12(9)5-8(6)10;/h3-5H,10H2,1-2H3;1H |
| InChIKey | WEVMJXCTANVREI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.67 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,7-dimethylimidazo[1,2-a]pyridin-6-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethylimidazo[1,2-a]pyridin-6-amine;hydrochloride?
The IUPAC name of 2,7-dimethylimidazo[1,2-a]pyridin-6-amine;hydrochloride (CID 121348410) is 2,7-dimethylimidazo[1,2-a]pyridin-6-amine;hydrochloride.
What is the SMILES notation for 2,7-dimethylimidazo[1,2-a]pyridin-6-amine;hydrochloride?
The canonical SMILES for 2,7-dimethylimidazo[1,2-a]pyridin-6-amine;hydrochloride is Cc1cn2cc(N)c(C)cc2n1.Cl.
What is the InChIKey of 2,7-dimethylimidazo[1,2-a]pyridin-6-amine;hydrochloride?
The InChIKey is WEVMJXCTANVREI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3.ClH/c1-6-3-9-11-7(2)4-12(9)5-8(6)10;/h3-5H,10H2,1-2H3;1H.
What are the key properties of 2,7-dimethylimidazo[1,2-a]pyridin-6-amine;hydrochloride?
2,7-dimethylimidazo[1,2-a]pyridin-6-amine;hydrochloride has a molecular weight of 197.67 g/mol, XLogP of 1.96, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethylimidazo[1,2-a]pyridin-6-amine;hydrochloride is sourced from PubChem (CID 121348410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).