C15H31N2+ — CID 121348526
1,1,2,4-tetrapropyl-4,5-dihydroimidazol-1-ium (PubChem CID 121348526) has the molecular formula C15H31N2+ and a molecular weight of 239.43 g/mol. Its IUPAC name is 1,1,2,4-tetrapropyl-4,5-dihydroimidazol-1-ium.
| Compound Name | 1,1,2,4-tetrapropyl-4,5-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 121348526 |
| Molecular Formula | C15H31N2+ |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.25 |
| IUPAC Name | 1,1,2,4-tetrapropyl-4,5-dihydroimidazol-1-ium |
| SMILES | CCCC1=NC(CCC)C[N+]1(CCC)CCC |
| InChI | InChI=1S/C15H31N2/c1-5-9-14-13-17(11-7-3,12-8-4)15(16-14)10-6-2/h14H,5-13H2,1-4H3/q+1 |
| InChIKey | KHVWQHOLZHAGOP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|