C19H12F3N3S — CID 121349963
2-[2-(2,4,5-trifluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl]thieno[3,2-c]pyridine (PubChem CID 121349963) has the molecular formula C19H12F3N3S and a molecular weight of 371.39 g/mol. Its IUPAC name is 2-[2-(2,4,5-trifluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl]thieno[3,2-c]pyridine.
| Compound Name | 2-[2-(2,4,5-trifluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl]thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 121349963 |
| Molecular Formula | C19H12F3N3S |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 2-[2-(2,4,5-trifluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl]thieno[3,2-c]pyridine |
| SMILES | Fc1cc(F)c(-c2nc3n(c2-c2cc4cnccc4s2)CCC3)cc1F |
| InChI | InChI=1S/C19H12F3N3S/c20-12-8-14(22)13(21)7-11(12)18-19(25-5-1-2-17(25)24-18)16-6-10-9-23-4-3-15(10)26-16/h3-4,6-9H,1-2,5H2 |
| InChIKey | BKPGRRVBGFDNTH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|