C18H12F3N5 — CID 121350087
6-[2-(2,3,5-trifluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl]-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 121350087) has the molecular formula C18H12F3N5 and a molecular weight of 355.32 g/mol. Its IUPAC name is 6-[2-(2,3,5-trifluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl]-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 6-[2-(2,3,5-trifluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl]-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 121350087 |
| Molecular Formula | C18H12F3N5 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 6-[2-(2,3,5-trifluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl]-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Fc1cc(F)c(F)c(-c2nc3n(c2-c2ccc4ncnn4c2)CCC3)c1 |
| InChI | InChI=1S/C18H12F3N5/c19-11-6-12(16(21)13(20)7-11)17-18(25-5-1-2-15(25)24-17)10-3-4-14-22-9-23-26(14)8-10/h3-4,6-9H,1-2,5H2 |
| InChIKey | RUAYOBDXGVXLNE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 48.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|