C37H18F6N8O2 — CID 121350178
5-imidazo[1,2-a]pyridin-6-yl-6-(2,4,5-trifluorophenyl)imidazo[2,1-b][1,3]oxazole;5-quinoxalin-6-yl-6-(2,4,5-trifluorophenyl)imidazo[2,1-b][1,3]oxazole (PubChem CID 121350178) has the molecular formula C37H18F6N8O2 and a molecular weight of 720.59 g/mol. Its IUPAC name is 5-imidazo[1,2-a]pyridin-6-yl-6-(2,4,5-trifluorophenyl)imidazo[2,1-b][1,3]oxazole;5-quinoxalin-6-yl-6-(2,4,5-trifluorophenyl)imidazo[2,1-b][1,3]oxazole.
| Compound Name | 5-imidazo[1,2-a]pyridin-6-yl-6-(2,4,5-trifluorophenyl)imidazo[2,1-b][1,3]oxazole;5-quinoxalin-6-yl-6-(2,4,5-trifluorophenyl)imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 121350178 |
| Molecular Formula | C37H18F6N8O2 |
| Molecular Weight | 720.59 g/mol |
| Exact Mass | 720.15 |
| IUPAC Name | 5-imidazo[1,2-a]pyridin-6-yl-6-(2,4,5-trifluorophenyl)imidazo[2,1-b][1,3]oxazole;5-quinoxalin-6-yl-6-(2,4,5-trifluorophenyl)imidazo[2,1-b][1,3]oxazole |
| SMILES | Fc1cc(F)c(-c2nc3occn3c2-c2ccc3nccn3c2)cc1F.Fc1cc(F)c(-c2nc3occn3c2-c2ccc3nccnc3c2)cc1F |
| InChI | InChI=1S/C19H9F3N4O.C18H9F3N4O/c20-12-9-14(22)13(21)8-11(12)17-18(26-5-6-27-19(26)25-17)10-1-2-15-16(7-10)24-4-3-23-15;19-12-8-14(21)13(20)7-11(12)16-17(25-5-6-26-18(25)23-16)10-1-2-15-22-3-4-24(15)9-10/h1-9H;1-9H |
| InChIKey | MPUPKDCKNHXHFG-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 103.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.59 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|