C19H9F3N4O — CID 121350272
5-quinoxalin-6-yl-6-(2,3,4-trifluorophenyl)imidazo[2,1-b][1,3]oxazole (PubChem CID 121350272) has the molecular formula C19H9F3N4O and a molecular weight of 366.30 g/mol. Its IUPAC name is 5-quinoxalin-6-yl-6-(2,3,4-trifluorophenyl)imidazo[2,1-b][1,3]oxazole.
| Compound Name | 5-quinoxalin-6-yl-6-(2,3,4-trifluorophenyl)imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 121350272 |
| Molecular Formula | C19H9F3N4O |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 5-quinoxalin-6-yl-6-(2,3,4-trifluorophenyl)imidazo[2,1-b][1,3]oxazole |
| SMILES | Fc1ccc(-c2nc3occn3c2-c2ccc3nccnc3c2)c(F)c1F |
| InChI | InChI=1S/C19H9F3N4O/c20-12-3-2-11(15(21)16(12)22)17-18(26-7-8-27-19(26)25-17)10-1-4-13-14(9-10)24-6-5-23-13/h1-9H |
| InChIKey | QCVPSYNVOSQDFL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|