C30H31ClF3N5O4 — CID 121350450
(9S)-4-chloro-N-[6-[3-(oxan-2-yloxy)propoxy]-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide (PubChem CID 121350450) has the molecular formula C30H31ClF3N5O4 and a molecular weight of 618.06 g/mol. Its IUPAC name is (9S)-4-chloro-N-[6-[3-(oxan-2-yloxy)propoxy]-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide.
| Compound Name | (9S)-4-chloro-N-[6-[3-(oxan-2-yloxy)propoxy]-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
|---|---|
| PubChem CID | 121350450 |
| Molecular Formula | C30H31ClF3N5O4 |
| Molecular Weight | 618.06 g/mol |
| Exact Mass | 617.20 |
| IUPAC Name | (9S)-4-chloro-N-[6-[3-(oxan-2-yloxy)propoxy]-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
| SMILES | O=C(Nc1cccc(OCCCOC2CCCCO2)n1)N1c2nc(-c3cccc(C(F)(F)F)c3)c(Cl)cc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C30H31ClF3N5O4/c31-22-17-23-28(37-27(22)19-6-3-7-20(16-19)30(32,33)34)39(21-11-12-38(23)18-21)29(40)36-24-8-4-9-25(35-24)41-14-5-15-43-26-10-1-2-13-42-26/h3-4,6-9,16-17,21,26H,1-2,5,10-15,18H2,(H,35,36,40)/t21-,26?/m0/s1 |
| InChIKey | SVZBUOISCFSEJX-GVNKFJBHSA-N |
| XLogP | 6.76 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.06 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|