C28H29F3N6O4 — CID 121350452
(9S)-N-[2-[2-(oxan-2-yloxy)ethoxy]pyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-11-carboxamide (PubChem CID 121350452) has the molecular formula C28H29F3N6O4 and a molecular weight of 570.57 g/mol. Its IUPAC name is (9S)-N-[2-[2-(oxan-2-yloxy)ethoxy]pyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-11-carboxamide.
| Compound Name | (9S)-N-[2-[2-(oxan-2-yloxy)ethoxy]pyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-11-carboxamide |
|---|---|
| PubChem CID | 121350452 |
| Molecular Formula | C28H29F3N6O4 |
| Molecular Weight | 570.57 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | (9S)-N-[2-[2-(oxan-2-yloxy)ethoxy]pyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-11-carboxamide |
| SMILES | O=C(Nc1ccnc(OCCOC2CCCCO2)n1)C1C[C@H]2CN1c1ccc(-c3cccc(C(F)(F)F)c3)nc1N2 |
| InChI | InChI=1S/C28H29F3N6O4/c29-28(30,31)18-5-3-4-17(14-18)20-7-8-21-25(34-20)33-19-15-22(37(21)16-19)26(38)35-23-9-10-32-27(36-23)41-13-12-40-24-6-1-2-11-39-24/h3-5,7-10,14,19,22,24H,1-2,6,11-13,15-16H2,(H,33,34)(H,32,35,36,38)/t19-,22?,24?/m0/s1 |
| InChIKey | DWGROXRPFRTKJL-HRRASNIPSA-N |
| XLogP | 4.49 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|