C27H28F3N5O3 — CID 121350528
(9S)-N-[6-(3-hydroxy-3-methylbutoxy)-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 121350528) has the molecular formula C27H28F3N5O3 and a molecular weight of 527.55 g/mol. Its IUPAC name is (9S)-N-[6-(3-hydroxy-3-methylbutoxy)-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-[6-(3-hydroxy-3-methylbutoxy)-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 121350528 |
| Molecular Formula | C27H28F3N5O3 |
| Molecular Weight | 527.55 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | (9S)-N-[6-(3-hydroxy-3-methylbutoxy)-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | CC(C)(O)CCOc1cccc(NC(=O)N2c3nc(-c4cccc(C(F)(F)F)c4)ccc3N3CC[C@H]2C3)n1 |
| InChI | InChI=1S/C27H28F3N5O3/c1-26(2,37)12-14-38-23-8-4-7-22(32-23)33-25(36)35-19-11-13-34(16-19)21-10-9-20(31-24(21)35)17-5-3-6-18(15-17)27(28,29)30/h3-10,15,19,37H,11-14,16H2,1-2H3,(H,32,33,36)/t19-/m0/s1 |
| InChIKey | IXKSSVHCYOJFOL-IBGZPJMESA-N |
| XLogP | 5.33 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.55 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |