C24H22ClF3N6O4 — CID 121350533
(9S)-4-chloro-N-[2-[(2R)-2,3-dihydroxypropoxy]pyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide (PubChem CID 121350533) has the molecular formula C24H22ClF3N6O4 and a molecular weight of 550.93 g/mol. Its IUPAC name is (9S)-4-chloro-N-[2-[(2R)-2,3-dihydroxypropoxy]pyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide.
| Compound Name | (9S)-4-chloro-N-[2-[(2R)-2,3-dihydroxypropoxy]pyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
|---|---|
| PubChem CID | 121350533 |
| Molecular Formula | C24H22ClF3N6O4 |
| Molecular Weight | 550.93 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | (9S)-4-chloro-N-[2-[(2R)-2,3-dihydroxypropoxy]pyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
| SMILES | O=C(Nc1ccnc(OC[C@H](O)CO)n1)N1c2nc(-c3cccc(C(F)(F)F)c3)c(Cl)cc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C24H22ClF3N6O4/c25-17-9-18-21(32-20(17)13-2-1-3-14(8-13)24(26,27)28)34(15-5-7-33(18)10-15)23(37)31-19-4-6-29-22(30-19)38-12-16(36)11-35/h1-4,6,8-9,15-16,35-36H,5,7,10-12H2,(H,29,30,31,37)/t15-,16+/m0/s1 |
| InChIKey | WLIKOYXQFKBOGT-JKSUJKDBSA-N |
| XLogP | 3.57 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.93 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |