C17H16F3N3 — CID 121350555
(9S)-3-methyl-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene (PubChem CID 121350555) has the molecular formula C17H16F3N3 and a molecular weight of 319.33 g/mol. Its IUPAC name is (9S)-3-methyl-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene.
| Compound Name | (9S)-3-methyl-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 121350555 |
| Molecular Formula | C17H16F3N3 |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | (9S)-3-methyl-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
| SMILES | Cc1cc(-c2cccc(C(F)(F)F)c2)nc2c1N1CC[C@@H](C1)N2 |
| InChI | InChI=1S/C17H16F3N3/c1-10-7-14(11-3-2-4-12(8-11)17(18,19)20)22-16-15(10)23-6-5-13(9-23)21-16/h2-4,7-8,13H,5-6,9H2,1H3,(H,21,22)/t13-/m0/s1 |
| InChIKey | NKSMHUWVKRIXPS-ZDUSSCGKSA-N |
| XLogP | 4.08 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |