C25H24F3N5O3 — CID 121350567
(9S)-N-[6-(3-hydroxypropoxy)-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 121350567) has the molecular formula C25H24F3N5O3 and a molecular weight of 499.49 g/mol. Its IUPAC name is (9S)-N-[6-(3-hydroxypropoxy)-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-[6-(3-hydroxypropoxy)-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 121350567 |
| Molecular Formula | C25H24F3N5O3 |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | (9S)-N-[6-(3-hydroxypropoxy)-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1cccc(OCCCO)n1)N1c2nc(-c3cccc(C(F)(F)F)c3)ccc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C25H24F3N5O3/c26-25(27,28)17-5-1-4-16(14-17)19-8-9-20-23(29-19)33(18-10-11-32(20)15-18)24(35)31-21-6-2-7-22(30-21)36-13-3-12-34/h1-2,4-9,14,18,34H,3,10-13,15H2,(H,30,31,35)/t18-/m0/s1 |
| InChIKey | QNHIJIWKQVMEET-SFHVURJKSA-N |
| XLogP | 4.55 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|