C26H26F3N5O4 — CID 121350576
(9S)-N-[2-[(2S)-2,3-dihydroxypropoxy]-4-pyridinyl]-4-methyl-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 121350576) has the molecular formula C26H26F3N5O4 and a molecular weight of 529.52 g/mol. Its IUPAC name is (9S)-N-[2-[(2S)-2,3-dihydroxypropoxy]-4-pyridinyl]-4-methyl-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-[2-[(2S)-2,3-dihydroxypropoxy]-4-pyridinyl]-4-methyl-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 121350576 |
| Molecular Formula | C26H26F3N5O4 |
| Molecular Weight | 529.52 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | (9S)-N-[2-[(2S)-2,3-dihydroxypropoxy]-4-pyridinyl]-4-methyl-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | Cc1cc2c(nc1-c1cccc(C(F)(F)F)c1)N(C(=O)Nc1ccnc(OC[C@@H](O)CO)c1)[C@H]1CCN2C1 |
| InChI | InChI=1S/C26H26F3N5O4/c1-15-9-21-24(32-23(15)16-3-2-4-17(10-16)26(27,28)29)34(19-6-8-33(21)12-19)25(37)31-18-5-7-30-22(11-18)38-14-20(36)13-35/h2-5,7,9-11,19-20,35-36H,6,8,12-14H2,1H3,(H,30,31,37)/t19-,20-/m0/s1 |
| InChIKey | VGTLSTIWTWRNOU-PMACEKPBSA-N |
| XLogP | 3.83 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |