C17H17F2N3 — CID 121350669
(9S)-5-[3-(difluoromethyl)phenyl]-4-methyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene (PubChem CID 121350669) has the molecular formula C17H17F2N3 and a molecular weight of 301.34 g/mol. Its IUPAC name is (9S)-5-[3-(difluoromethyl)phenyl]-4-methyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene.
| Compound Name | (9S)-5-[3-(difluoromethyl)phenyl]-4-methyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 121350669 |
| Molecular Formula | C17H17F2N3 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | (9S)-5-[3-(difluoromethyl)phenyl]-4-methyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
| SMILES | Cc1cc2c(nc1-c1cccc(C(F)F)c1)N[C@H]1CCN2C1 |
| InChI | InChI=1S/C17H17F2N3/c1-10-7-14-17(20-13-5-6-22(14)9-13)21-15(10)11-3-2-4-12(8-11)16(18)19/h2-4,7-8,13,16H,5-6,9H2,1H3,(H,20,21)/t13-/m0/s1 |
| InChIKey | WYKOGXZQZVUWMR-ZDUSSCGKSA-N |
| XLogP | 4.00 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |