C26H27F3N6O3 — CID 121350674
(9S)-N-[2-(3-hydroxy-3-methylbutoxy)pyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 121350674) has the molecular formula C26H27F3N6O3 and a molecular weight of 528.54 g/mol. Its IUPAC name is (9S)-N-[2-(3-hydroxy-3-methylbutoxy)pyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-[2-(3-hydroxy-3-methylbutoxy)pyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 121350674 |
| Molecular Formula | C26H27F3N6O3 |
| Molecular Weight | 528.54 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | (9S)-N-[2-(3-hydroxy-3-methylbutoxy)pyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | CC(C)(O)CCOc1nccc(NC(=O)N2c3nc(-c4cccc(C(F)(F)F)c4)ccc3N3CC[C@H]2C3)n1 |
| InChI | InChI=1S/C26H27F3N6O3/c1-25(2,37)10-13-38-23-30-11-8-21(32-23)33-24(36)35-18-9-12-34(15-18)20-7-6-19(31-22(20)35)16-4-3-5-17(14-16)26(27,28)29/h3-8,11,14,18,37H,9-10,12-13,15H2,1-2H3,(H,30,32,33,36)/t18-/m0/s1 |
| InChIKey | BATSPIDCHAWOPN-SFHVURJKSA-N |
| XLogP | 4.73 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |