C14H14BrFN2O3S — CID 121350678
2-[[2-[4-(bromomethyl)phenyl]-5-methyl-1,3-oxazol-4-yl]methylsulfinyl]-N-fluoroacetamide (PubChem CID 121350678) has the molecular formula C14H14BrFN2O3S and a molecular weight of 389.25 g/mol. Its IUPAC name is 2-[[2-[4-(bromomethyl)phenyl]-5-methyl-1,3-oxazol-4-yl]methylsulfinyl]-N-fluoroacetamide.
| Compound Name | 2-[[2-[4-(bromomethyl)phenyl]-5-methyl-1,3-oxazol-4-yl]methylsulfinyl]-N-fluoroacetamide |
|---|---|
| PubChem CID | 121350678 |
| Molecular Formula | C14H14BrFN2O3S |
| Molecular Weight | 389.25 g/mol |
| Exact Mass | 387.99 |
| IUPAC Name | 2-[[2-[4-(bromomethyl)phenyl]-5-methyl-1,3-oxazol-4-yl]methylsulfinyl]-N-fluoroacetamide |
| SMILES | Cc1oc(-c2ccc(CBr)cc2)nc1CS(=O)CC(=O)NF |
| InChI | InChI=1S/C14H14BrFN2O3S/c1-9-12(7-22(20)8-13(19)18-16)17-14(21-9)11-4-2-10(6-15)3-5-11/h2-5H,6-8H2,1H3,(H,18,19) |
| InChIKey | WWQNMUZSLWBADK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.25 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|