C20H18ClF3N4O — CID 121350684
(9S)-4-chloro-N-cyclopropyl-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide (PubChem CID 121350684) has the molecular formula C20H18ClF3N4O and a molecular weight of 422.84 g/mol. Its IUPAC name is (9S)-4-chloro-N-cyclopropyl-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide.
| Compound Name | (9S)-4-chloro-N-cyclopropyl-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
|---|---|
| PubChem CID | 121350684 |
| Molecular Formula | C20H18ClF3N4O |
| Molecular Weight | 422.84 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | (9S)-4-chloro-N-cyclopropyl-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
| SMILES | O=C(NC1CC1)N1c2nc(-c3cccc(C(F)(F)F)c3)c(Cl)cc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C20H18ClF3N4O/c21-15-9-16-18(26-17(15)11-2-1-3-12(8-11)20(22,23)24)28(14-6-7-27(16)10-14)19(29)25-13-4-5-13/h1-3,8-9,13-14H,4-7,10H2,(H,25,29)/t14-/m0/s1 |
| InChIKey | USVSESPUBWNHDL-AWEZNQCLSA-N |
| XLogP | 4.69 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.84 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |