C27H27ClF3N5O3 — CID 121350693
(9S)-4-chloro-N-[6-(3-hydroxy-3-methylbutoxy)-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide (PubChem CID 121350693) has the molecular formula C27H27ClF3N5O3 and a molecular weight of 561.99 g/mol. Its IUPAC name is (9S)-4-chloro-N-[6-(3-hydroxy-3-methylbutoxy)-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide.
| Compound Name | (9S)-4-chloro-N-[6-(3-hydroxy-3-methylbutoxy)-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
|---|---|
| PubChem CID | 121350693 |
| Molecular Formula | C27H27ClF3N5O3 |
| Molecular Weight | 561.99 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | (9S)-4-chloro-N-[6-(3-hydroxy-3-methylbutoxy)-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
| SMILES | CC(C)(O)CCOc1cccc(NC(=O)N2c3nc(-c4cccc(C(F)(F)F)c4)c(Cl)cc3N3CC[C@H]2C3)n1 |
| InChI | InChI=1S/C27H27ClF3N5O3/c1-26(2,38)10-12-39-22-8-4-7-21(32-22)33-25(37)36-18-9-11-35(15-18)20-14-19(28)23(34-24(20)36)16-5-3-6-17(13-16)27(29,30)31/h3-8,13-14,18,38H,9-12,15H2,1-2H3,(H,32,33,37)/t18-/m0/s1 |
| InChIKey | GJLHUUASGYCWFR-SFHVURJKSA-N |
| XLogP | 5.99 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.99 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |