C25H23ClF3N5O4 — CID 121350721
4-chloro-N-[4-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide (PubChem CID 121350721) has the molecular formula C25H23ClF3N5O4 and a molecular weight of 549.94 g/mol. Its IUPAC name is 4-chloro-N-[4-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide.
| Compound Name | 4-chloro-N-[4-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
|---|---|
| PubChem CID | 121350721 |
| Molecular Formula | C25H23ClF3N5O4 |
| Molecular Weight | 549.94 g/mol |
| Exact Mass | 549.14 |
| IUPAC Name | 4-chloro-N-[4-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
| SMILES | O=C(Nc1cc(OC[C@H](O)CO)ccn1)N1c2nc(-c3cccc(C(F)(F)F)c3)c(Cl)cc2N2CCC1C2 |
| InChI | InChI=1S/C25H23ClF3N5O4/c26-19-10-20-23(32-22(19)14-2-1-3-15(8-14)25(27,28)29)34(16-5-7-33(20)11-16)24(37)31-21-9-18(4-6-30-21)38-13-17(36)12-35/h1-4,6,8-10,16-17,35-36H,5,7,11-13H2,(H,30,31,37)/t16?,17-/m1/s1 |
| InChIKey | BWVHGQQABQBRFN-ZYMOGRSISA-N |
| XLogP | 4.18 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.94 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |