C28H28ClF3N6O4 — CID 121350761
(9S)-4-chloro-N-[2-[2-(oxan-2-yloxy)ethoxy]pyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide (PubChem CID 121350761) has the molecular formula C28H28ClF3N6O4 and a molecular weight of 605.02 g/mol. Its IUPAC name is (9S)-4-chloro-N-[2-[2-(oxan-2-yloxy)ethoxy]pyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide.
| Compound Name | (9S)-4-chloro-N-[2-[2-(oxan-2-yloxy)ethoxy]pyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
|---|---|
| PubChem CID | 121350761 |
| Molecular Formula | C28H28ClF3N6O4 |
| Molecular Weight | 605.02 g/mol |
| Exact Mass | 604.18 |
| IUPAC Name | (9S)-4-chloro-N-[2-[2-(oxan-2-yloxy)ethoxy]pyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
| SMILES | O=C(Nc1ccnc(OCCOC2CCCCO2)n1)N1c2nc(-c3cccc(C(F)(F)F)c3)c(Cl)cc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C28H28ClF3N6O4/c29-20-15-21-25(36-24(20)17-4-3-5-18(14-17)28(30,31)32)38(19-8-10-37(21)16-19)27(39)35-22-7-9-33-26(34-22)42-13-12-41-23-6-1-2-11-40-23/h3-5,7,9,14-15,19,23H,1-2,6,8,10-13,16H2,(H,33,34,35,39)/t19-,23?/m0/s1 |
| InChIKey | ADWMPUZDHVFXMR-HSTJUUNISA-N |
| XLogP | 5.76 |
| TPSA | 101.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.02 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|