C20H12F9N3O3S — CID 121350780
1-[3,5-bis(trifluoromethyl)phenyl]-5,5-dimethyl-3-[4-nitro-3-(trifluoromethyl)phenyl]-2-sulfanylideneimidazolidin-4-one (PubChem CID 121350780) has the molecular formula C20H12F9N3O3S and a molecular weight of 545.38 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-5,5-dimethyl-3-[4-nitro-3-(trifluoromethyl)phenyl]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-5,5-dimethyl-3-[4-nitro-3-(trifluoromethyl)phenyl]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 121350780 |
| Molecular Formula | C20H12F9N3O3S |
| Molecular Weight | 545.38 g/mol |
| Exact Mass | 545.05 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-5,5-dimethyl-3-[4-nitro-3-(trifluoromethyl)phenyl]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CC1(C)C(=O)N(c2ccc([N+](=O)[O-])c(C(F)(F)F)c2)C(=S)N1c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H12F9N3O3S/c1-17(2)15(33)30(11-3-4-14(32(34)35)13(8-11)20(27,28)29)16(36)31(17)12-6-9(18(21,22)23)5-10(7-12)19(24,25)26/h3-8H,1-2H3 |
| InChIKey | OBQHQVYCSVCYII-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.38 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|