C11H12N2Na2O7P2 — CID 121350811
disodium;hydroxy-[1-hydroxy-2-(3-phenylimidazol-1-ium-1-yl)-1-phosphonatoethyl]phosphinate (PubChem CID 121350811) has the molecular formula C11H12N2Na2O7P2 and a molecular weight of 392.15 g/mol. Its IUPAC name is disodium;hydroxy-[1-hydroxy-2-(3-phenylimidazol-1-ium-1-yl)-1-phosphonatoethyl]phosphinate.
| Compound Name | disodium;hydroxy-[1-hydroxy-2-(3-phenylimidazol-1-ium-1-yl)-1-phosphonatoethyl]phosphinate |
|---|---|
| PubChem CID | 121350811 |
| Molecular Formula | C11H12N2Na2O7P2 |
| Molecular Weight | 392.15 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | disodium;hydroxy-[1-hydroxy-2-(3-phenylimidazol-1-ium-1-yl)-1-phosphonatoethyl]phosphinate |
| SMILES | O=P([O-])([O-])C(O)(C[n+]1ccn(-c2ccccc2)c1)P(=O)([O-])O.[Na+].[Na+] |
| InChI | InChI=1S/C11H14N2O7P2.2Na/c14-11(21(15,16)17,22(18,19)20)8-12-6-7-13(9-12)10-4-2-1-3-5-10;;/h1-7,9,14H,8H2,(H3-,15,16,17,18,19,20);;/q;2*+1/p-2 |
| InChIKey | DAWPFNWQLAETBH-UHFFFAOYSA-L |
| XLogP | -8.12 |
| TPSA | 152.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.15 |
| LogP ≤ 5 | -8.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|