About [(7Z)-7-methoxyimino-5,6-dihydrocyclopenta[b]pyridin-6-yl] acetate
[(7Z)-7-methoxyimino-5,6-dihydrocyclopenta[b]pyridin-6-yl] acetate (PubChem CID 121351008) has the molecular formula C11H12N2O3
and a molecular weight of 220.23 g/mol. Its IUPAC name is [(7Z)-7-methoxyimino-5,6-dihydrocyclopenta[b]pyridin-6-yl] acetate.
Molecular Properties
| Compound Name | [(7Z)-7-methoxyimino-5,6-dihydrocyclopenta[b]pyridin-6-yl] acetate |
| PubChem CID | 121351008 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | [(7Z)-7-methoxyimino-5,6-dihydrocyclopenta[b]pyridin-6-yl] acetate |
| SMILES | CO/N=C1/c2ncccc2CC1OC(C)=O |
| InChI | InChI=1S/C11H12N2O3/c1-7(14)16-9-6-8-4-3-5-12-10(8)11(9)13-15-2/h3-5,9H,6H2,1-2H3/b13-11+ |
| InChIKey | ZGNOPFKOKWURAW-ACCUITESSA-N |
| XLogP | 0.92 |
| TPSA | 60.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(7Z)-7-methoxyimino-5,6-dihydrocyclopenta[b]pyridin-6-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(7Z)-7-methoxyimino-5,6-dihydrocyclopenta[b]pyridin-6-yl] acetate?
The IUPAC name of [(7Z)-7-methoxyimino-5,6-dihydrocyclopenta[b]pyridin-6-yl] acetate (CID 121351008) is [(7Z)-7-methoxyimino-5,6-dihydrocyclopenta[b]pyridin-6-yl] acetate.
What is the SMILES notation for [(7Z)-7-methoxyimino-5,6-dihydrocyclopenta[b]pyridin-6-yl] acetate?
The canonical SMILES for [(7Z)-7-methoxyimino-5,6-dihydrocyclopenta[b]pyridin-6-yl] acetate is CO/N=C1/c2ncccc2CC1OC(C)=O.
What is the InChIKey of [(7Z)-7-methoxyimino-5,6-dihydrocyclopenta[b]pyridin-6-yl] acetate?
The InChIKey is ZGNOPFKOKWURAW-ACCUITESSA-N. The full InChI is InChI=1S/C11H12N2O3/c1-7(14)16-9-6-8-4-3-5-12-10(8)11(9)13-15-2/h3-5,9H,6H2,1-2H3/b13-11+.
What are the key properties of [(7Z)-7-methoxyimino-5,6-dihydrocyclopenta[b]pyridin-6-yl] acetate?
[(7Z)-7-methoxyimino-5,6-dihydrocyclopenta[b]pyridin-6-yl] acetate has a molecular weight of 220.23 g/mol, XLogP of 0.92, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(7Z)-7-methoxyimino-5,6-dihydrocyclopenta[b]pyridin-6-yl] acetate is sourced from PubChem (CID 121351008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).