C16H17N5O2 — CID 121351047
3-amino-N-[(1S,2R)-2-ethynylcyclopentyl]-6-methyl-5-(1,3-oxazol-2-yl)pyrazine-2-carboxamide (PubChem CID 121351047) has the molecular formula C16H17N5O2 and a molecular weight of 311.35 g/mol. Its IUPAC name is 3-amino-N-[(1S,2R)-2-ethynylcyclopentyl]-6-methyl-5-(1,3-oxazol-2-yl)pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[(1S,2R)-2-ethynylcyclopentyl]-6-methyl-5-(1,3-oxazol-2-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 121351047 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 3-amino-N-[(1S,2R)-2-ethynylcyclopentyl]-6-methyl-5-(1,3-oxazol-2-yl)pyrazine-2-carboxamide |
| SMILES | C#C[C@H]1CCC[C@@H]1NC(=O)c1nc(C)c(-c2ncco2)nc1N |
| InChI | InChI=1S/C16H17N5O2/c1-3-10-5-4-6-11(10)20-15(22)13-14(17)21-12(9(2)19-13)16-18-7-8-23-16/h1,7-8,10-11H,4-6H2,2H3,(H2,17,21)(H,20,22)/t10-,11-/m0/s1 |
| InChIKey | LRNQTTXWLSXPMO-QWRGUYRKSA-N |
| XLogP | 1.55 |
| TPSA | 106.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|