C15H16O6 — CID 121351241
diethyl 4,7-dioxo-1,3-dihydroindene-2,2-dicarboxylate (PubChem CID 121351241) has the molecular formula C15H16O6 and a molecular weight of 292.29 g/mol. Its IUPAC name is diethyl 4,7-dioxo-1,3-dihydroindene-2,2-dicarboxylate.
| Compound Name | diethyl 4,7-dioxo-1,3-dihydroindene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 121351241 |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | diethyl 4,7-dioxo-1,3-dihydroindene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2=C(C1)C(=O)C=CC2=O |
| InChI | InChI=1S/C15H16O6/c1-3-20-13(18)15(14(19)21-4-2)7-9-10(8-15)12(17)6-5-11(9)16/h5-6H,3-4,7-8H2,1-2H3 |
| InChIKey | JWRUUVIRNMLDOQ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|