C23H26F2N6O5 — CID 121351610
(9S)-5-N-(2,2-difluorocyclopropyl)-8-N-[4-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 121351610) has the molecular formula C23H26F2N6O5 and a molecular weight of 504.49 g/mol. Its IUPAC name is (9S)-5-N-(2,2-difluorocyclopropyl)-8-N-[4-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | (9S)-5-N-(2,2-difluorocyclopropyl)-8-N-[4-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121351610 |
| Molecular Formula | C23H26F2N6O5 |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | (9S)-5-N-(2,2-difluorocyclopropyl)-8-N-[4-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | O=C(NC1CC1(F)F)c1ccc2c(n1)N(C(=O)Nc1cc(OC[C@H](O)CO)ccn1)[C@H]1CCCN2C1 |
| InChI | InChI=1S/C23H26F2N6O5/c24-23(25)9-18(23)28-21(34)16-3-4-17-20(27-16)31(13-2-1-7-30(17)10-13)22(35)29-19-8-15(5-6-26-19)36-12-14(33)11-32/h3-6,8,13-14,18,32-33H,1-2,7,9-12H2,(H,28,34)(H,26,29,35)/t13-,14+,18?/m0/s1 |
| InChIKey | BZPFWHDXTOTUDO-BWLUYJDISA-N |
| XLogP | 1.37 |
| TPSA | 140.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |