C26H25ClF3N5O4 — CID 121351611
(9S)-4-chloro-N-[6-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxamide (PubChem CID 121351611) has the molecular formula C26H25ClF3N5O4 and a molecular weight of 563.96 g/mol. Its IUPAC name is (9S)-4-chloro-N-[6-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxamide.
| Compound Name | (9S)-4-chloro-N-[6-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxamide |
|---|---|
| PubChem CID | 121351611 |
| Molecular Formula | C26H25ClF3N5O4 |
| Molecular Weight | 563.96 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | (9S)-4-chloro-N-[6-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxamide |
| SMILES | O=C(Nc1cccc(OC[C@H](O)CO)n1)N1c2nc(-c3cccc(C(F)(F)F)c3)c(Cl)cc2N2CCC[C@H]1C2 |
| InChI | InChI=1S/C26H25ClF3N5O4/c27-19-11-20-24(33-23(19)15-4-1-5-16(10-15)26(28,29)30)35(17-6-3-9-34(20)12-17)25(38)32-21-7-2-8-22(31-21)39-14-18(37)13-36/h1-2,4-5,7-8,10-11,17-18,36-37H,3,6,9,12-14H2,(H,31,32,38)/t17-,18+/m0/s1 |
| InChIKey | IAXXUXWSCHCOGD-ZWKOTPCHSA-N |
| XLogP | 4.57 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.96 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |