C26H31F2N6O5+ — CID 121351613
(9S)-6-(2,2-difluorocyclopropyl)-8-[4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-2-pyridinyl]-1,8-diaza-6-azoniatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11,12-dicarboxamide (PubChem CID 121351613) has the molecular formula C26H31F2N6O5+ and a molecular weight of 545.57 g/mol. Its IUPAC name is (9S)-6-(2,2-difluorocyclopropyl)-8-[4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-2-pyridinyl]-1,8-diaza-6-azoniatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11,12-dicarboxamide.
| Compound Name | (9S)-6-(2,2-difluorocyclopropyl)-8-[4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-2-pyridinyl]-1,8-diaza-6-azoniatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11,12-dicarboxamide |
|---|---|
| PubChem CID | 121351613 |
| Molecular Formula | C26H31F2N6O5+ |
| Molecular Weight | 545.57 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | (9S)-6-(2,2-difluorocyclopropyl)-8-[4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-2-pyridinyl]-1,8-diaza-6-azoniatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11,12-dicarboxamide |
| SMILES | CC1(C)OC[C@H](COc2ccnc(N3c4c(ccc[n+]4C4CC4(F)F)N4C[C@@H]3CC(C(N)=O)C4C(N)=O)c2)O1 |
| InChI | InChI=1S/C26H30F2N6O5/c1-25(2)38-13-16(39-25)12-37-15-5-6-31-20(9-15)34-14-8-17(22(29)35)21(23(30)36)33(11-14)18-4-3-7-32(24(18)34)19-10-26(19,27)28/h3-7,9,14,16-17,19,21H,8,10-13H2,1-2H3,(H3-,29,30,35,36)/p+1/t14-,16-,17?,19?,21?/m0/s1 |
| InChIKey | KAYGHHDFNSKNGX-GILTXSMLSA-O |
| XLogP | 1.17 |
| TPSA | 137.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.57 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|