C15H19F3N4O — CID 121351641
3-methyl-N-(1,1,1-trifluoropropan-2-yl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5-carboxamide (PubChem CID 121351641) has the molecular formula C15H19F3N4O and a molecular weight of 328.34 g/mol. Its IUPAC name is 3-methyl-N-(1,1,1-trifluoropropan-2-yl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5-carboxamide.
| Compound Name | 3-methyl-N-(1,1,1-trifluoropropan-2-yl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5-carboxamide |
|---|---|
| PubChem CID | 121351641 |
| Molecular Formula | C15H19F3N4O |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 3-methyl-N-(1,1,1-trifluoropropan-2-yl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5-carboxamide |
| SMILES | Cc1cc(C(=O)NC(C)C(F)(F)F)nc2c1N1CCCC(C1)N2 |
| InChI | InChI=1S/C15H19F3N4O/c1-8-6-11(14(23)19-9(2)15(16,17)18)21-13-12(8)22-5-3-4-10(7-22)20-13/h6,9-10H,3-5,7H2,1-2H3,(H,19,23)(H,20,21) |
| InChIKey | NHMMJCAFQBZAGZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |