C21H21F3N8O2 — CID 121351661
8-N-(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 121351661) has the molecular formula C21H21F3N8O2 and a molecular weight of 474.45 g/mol. Its IUPAC name is 8-N-(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | 8-N-(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121351661 |
| Molecular Formula | C21H21F3N8O2 |
| Molecular Weight | 474.45 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 8-N-(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | Cc1ccc2c(NC(=O)N3c4nc(C(=O)NCC(F)(F)F)ccc4N4CCCC3C4)n[nH]c2n1 |
| InChI | InChI=1S/C21H21F3N8O2/c1-11-4-5-13-16(26-11)29-30-17(13)28-20(34)32-12-3-2-8-31(9-12)15-7-6-14(27-18(15)32)19(33)25-10-21(22,23)24/h4-7,12H,2-3,8-10H2,1H3,(H,25,33)(H2,26,28,29,30,34) |
| InChIKey | HYQCPSTXDPKVPN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 119.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |